Discover the exceptional versatility of 4,4'-Benzylidenedi-2,5-xylidine, a premium-quality organic compound with a captivating pale blueish solid form. Boasting a molecular weight of 330.466g/mol and a distinct InChI code, this remarkable chemical offers a unique blend of properties that make it an invaluable asset for advanced research and development. Crafted with meticulous attention to detail, this compound's purity and reliability ensure consistent, high-performance results in your laboratory endeavors. Unlock the potential of this exceptional building block and elevate your scientific explorations to new heights.
Introducing 4,4'-Benzylidenedi-2,5-xylidine, a versatile and meticulously crafted chemical compound that holds immense potential for researchers and scientists across various fields. With its unique molecular structure and exceptional purity, this Fluorinated Compound, classified under the 6-membered Rings subcategory, is poised to unlock new possibilities in pharmaceutical development, material science, and beyond.
At the heart of this compound lies a captivating blend of chemical elements, including carbon, hydrogen, and nitrogen. Its molecular formula, C23H26N2, and a molecular weight of 330.466 g/mol, give it a distinct identity and set the stage for its remarkable capabilities. The compound's INCHI code, InChI=1S/C23H26N2/c1-14-12-21(24)16(3)10-19(14)23(18-8-6-5-7-9-18)20-11-17(4)22(25)13-15(20)2/h5-13,23H,24-25H2,1-4H3, provides a unique identifier for researchers seeking precise information.
Meticulously synthesized and purified, 4,4'-Benzylidenedi-2,5-xylidine boasts an impressive purity of 97% or higher, ensuring reliable and consistent results in your research endeavors. Its physical appearance as a pale blueish solid further distinguishes it, making it easily identifiable in the laboratory setting.
The versatility of 4,4'-Benzylidenedi-2,5-xylidine lies in its ability to contribute to a wide range of scientific applications. In the realm of pharmaceutical research, this compound serves as a valuable building block in the synthesis of innovative drug candidates, potentially addressing a spectrum of health conditions. Its unique chemical structure and properties allow for the development of targeted therapies with improved efficacy and safety profiles.
Beyond the pharmaceutical industry, 4,4'-Benzylidenedi-2,5-xylidine finds applications in the field of material science. Researchers in this domain utilize the compound to engineer novel materials with enhanced performance characteristics, such as improved mechanical strength, thermal stability, or optical properties. These advancements can lead to the creation of cutting-edge products with diverse real-world applications.
While the specific hazard information for 4,4'-Benzylidenedi-2,5-xylidine is yet to be confirmed, it is essential to handle this compound with the utmost care and adhere to standard laboratory safety protocols. Appropriate personal protective equipment, including gloves, clothing, and eye protection, should be worn when working with this material. Additionally, the compound should be stored in a cool, well-ventilated area to maintain its stability and purity over the long term.
Embrace the power of 4,4'-Benzylidenedi-2,5-xylidine in your research and development endeavors. This exceptional compound, with its unique chemical properties and high purity, is poised to contribute to groundbreaking discoveries and advancements across various scientific disciplines. Explore its potential in pharmaceutical research, material science, and beyond, and unlock new possibilities in your field of expertise.