Discover the captivating essence of 3-Hydroxy-1H-indazole, a versatile Building Block that unlocks a world of possibilities. This sandy powder compound, with a purity of 98% and a molecular weight of 134.14g/mol, boasts a unique chemical structure that sets it apart. Featuring the CAS number 100922-96-1 and the EINECS number 230-904-2, this exceptional product offers a blend of reactivity and selectivity, making it an invaluable asset for your research and development projects. However, handle with care as it is classified as an irritant, causing skin, eye, and respiratory discomfort. Always store in a cool, well-ventilated area and wear appropriate protective gear. Embrace the potential of this remarkable compound and elevate your experiments to new heights of success.
Unlock the versatile potential of 3-Hydroxy-1H-indazole, a meticulously crafted chemical compound that holds the key to unlocking new frontiers in scientific research and development. This remarkable molecule, identified by the CAS number 100922-96-1, boasts a unique structure and a purity of 98%, making it an invaluable asset for researchers and scientists across various disciplines.
As a member of the Indazoles family, 3-Hydroxy-1H-indazole presents a captivating blend of chemical properties that have captured the attention of the scientific community. Its distinct molecular formula, C7H6N2O, and a molecular weight of 134.14g/mol, endow it with a remarkable versatility that can be harnessed to drive innovation in a multitude of applications.
In the realm of pharmaceutical research, 3-Hydroxy-1H-indazole shines as a valuable building block in the synthesis of novel drug candidates. Its unique structural features allow for the development of targeted therapies that address a wide range of health conditions, from neurological disorders to metabolic diseases. Researchers can leverage the compound's inherent properties to design innovative molecules with enhanced pharmacological profiles, ultimately leading to more effective and safer treatments for patients in need.
The versatility of 3-Hydroxy-1H-indazole extends beyond the pharmaceutical realm, as it also finds applications in the agrochemical industry. This compound serves as a crucial starting material in the synthesis of advanced crop protection agents, such as potent and selective pesticides. By harnessing the compound's distinct chemical characteristics, researchers can formulate agrochemicals that promote healthier crops, higher yields, and a more sustainable agricultural landscape.
Beyond its pharmaceutical and agrochemical applications, 3-Hydroxy-1H-indazole is a versatile tool in the realm of chemical synthesis. Its unique molecular structure and reactivity make it a valuable reagent in the creation of novel compounds with tailored properties. Whether it's the development of new materials, the exploration of innovative reaction pathways, or the synthesis of complex organic molecules, this compound opens up a world of possibilities for researchers and chemists seeking to push the boundaries of scientific discovery.
3-Hydroxy-1H-indazole is a sandy powder with a melting point range of 224-226°C, ensuring its stability and reliability in various experimental settings. Its chemical identity is further defined by the INCHI code InChI=1S/C7H6N2O/c10-7-5-3-1-2-4-6(5)8-9-7/h1-4H,(H2,8,9,10) and the SMILES notation Oc1n[nH]c2ccccc12.
While this compound is classified as an irritant, with hazard statements H315, H319, and H335, proper handling and safety precautions can mitigate any potential risks. Users should wear protective gloves, clothing, eye protection, and work in a well-ventilated area to ensure their safety and the integrity of the compound during use.
Embark on your scientific journey with 3-Hydroxy-1H-indazole, a versatile and high-purity compound that holds the key to unlocking new frontiers in pharmaceutical research, agrochemical development, and chemical synthesis. Leverage its unique properties to drive innovation, create groundbreaking discoveries, and contribute to the advancement of scientific knowledge.
Explore the wealth of resources available, including technical data sheets, safety guidelines, and application-specific literature, to fully harness the potential of this remarkable compound. Unlock the possibilities and let 3-Hydroxy-1H-indazole be your guide to a future filled with scientific breakthroughs