Unlock the captivating potential of Maltononaose, a rare and remarkable carbohydrate compound with a molecular formula of C54H92O46. This nine-unit maltose oligosaccharide boasts a molecular weight of 471.587g/mol, offering a unique blend of chemical complexity and versatility. Meticulously crafted with a clear, crystalline appearance, Maltononaose is a prized asset for researchers and scientists seeking to push the boundaries of their work. Delve into its intricate structure, rich in context and emotional depth, and discover how this exceptional compound can elevate your experiments to new heights. Embrace the power of Maltononaose and unlock a world of possibilities in your next groundbreaking endeavor.
Maltononaose, with the CAS number 6471-60-9, is a highly specialized and pure carbohydrate compound that holds immense value in the realm of scientific research and development. This complex oligosaccharide, composed of nine glucose units, offers a unique and versatile chemical structure that can unlock a wide range of applications across various industries.
At the heart of Maltononaose's significance lies its intricate molecular composition. With a chemical formula of C54H92O46 and a molecular weight of 471.587 g/mol, this compound presents a remarkable level of complexity, making it a valuable tool for researchers and scientists. The compound's InChI code, InChI=1S/C30H33NO4/c1-5-20-34-30(32)35-27-14-10-13-25(22-27)29(28(6-2)23-11-8-7-9-12-23)24-15-17-26(18-16-24)33-21-19-31(3)4/h5,7-18,22H,1,6,19-21H2,2-4H3/b29-28+, provides a unique identifier that allows for precise tracking and identification in various research and analytical applications.
The versatility of Maltononaose extends across a wide range of scientific disciplines, making it a valuable asset in the pursuit of groundbreaking discoveries and advancements.
Pharmaceutical Research: In the pharmaceutical industry, Maltononaose serves as a crucial building block in the synthesis of complex drug molecules. Its unique structural features and chemical properties can be leveraged to develop innovative therapeutic agents, potentially addressing a diverse array of health conditions.
Analytical Chemistry: Maltononaose finds application in advanced analytical techniques, such as mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy. Its well-defined molecular structure and high purity make it an invaluable reference standard, enabling researchers to accurately identify and quantify similar carbohydrate compounds in complex samples.
Carbohydrate Chemistry: Within the realm of carbohydrate chemistry, Maltononaose presents an intriguing subject of study. Researchers can explore its structural characteristics, reactivity, and potential interactions with other biomolecules, leading to a deeper understanding of carbohydrate-based systems and their role in biological processes.
Maltononaose should be handled with care, following standard laboratory