Traumatin

Traumatin, with the CAS number 65410-38-0, is a highly versatile and intriguing fatty acid compound that holds immense potential for a wide range of scientific and industrial applications. This unique chemical entity, known for its distinct structural characteristics, has captured the attention of researchers and innovators across various fields, from pharmaceuticals to material science.

At the heart of Traumatin's allure lies its captivating molecular structure. Boasting the chemical formula C12H20O3, this compound features a 12-carbon chain with a carbonyl group and a carboxylic acid moiety. Its InChI code, InChI=1S/C12H20O3/c13-11-9-7-5-3-1-2-4-6-8-10-12(14)15/h7,9,11H,1-6,8,10H2,(H,14,15)/b9-7+, provides a unique identifier that allows researchers to delve deeper into its intricate details.

Unlocking the Potential of Traumatin

Traumatin's versatility is truly remarkable, as it finds applications in a diverse array of industries and research domains. Its unique chemical properties and structural features make it a valuable asset in the pursuit of groundbreaking discoveries and innovative solutions.

Pharmaceutical Research: In the realm of pharmaceuticals, Traumatin serves as a crucial building block in the synthesis of novel drug candidates. Its distinct molecular architecture allows for the development of targeted therapies that address a wide range of health conditions, from inflammatory disorders to metabolic imbalances. Researchers leverage Traumatin's inherent properties to design innovative pharmaceutical compounds with enhanced efficacy and improved pharmacological profiles.

Agrochemical Development: The agricultural sector also benefits from the versatility of Traumatin. This compound finds application in the synthesis of advanced crop protection agents, such as pesticides and herbicides. Its unique structure contributes to the formulation of highly selective and potent agrochemicals, helping to safeguard crops, increase yields, and promote sustainable farming practices.

Material Science Innovations: Beyond the realms of pharmaceuticals and agrochemicals, Traumatin's potential extends to the field of material science. Researchers in this domain explore the integration of Traumatin into the development of novel materials with tailored properties. Its chemical structure and reactivity can be leveraged to create materials with enhanced thermal stability, mechanical strength, or even unique optical characteristics, opening up new avenues for technological advancements.

Technical Specifications and Handling

Traumatin, with a molecular weight of 212.285 g/mol, is a clear, pale-colored liquid that exhibits a distinct chemical profile. Its IUPAC name, (E)-12-oxododec-10-enoic acid, further highlights its structural uniqueness. To ensure the highest quality and purity, Traumatin is meticulously produced and rigorously tested, with a purity level that meets the stringent requirements of research and industrial applications.

When handling Traumatin, it is essential to follow appropriate safety protocols. As with any chemical compound, proper personal protective equipment (PPE), such as gloves, goggles, and a well-ventilated work area, should be utilized. Additionally, Traumatin should be stored in a cool, dry environment to maintain its stability and integrity over the long term.

Unlocking the Potential of Traumatin

Traumatin's versatility and unique properties make it a compelling choice for researchers and innovators seeking to push the boundaries of scientific discovery. Whether you're exploring new pharmaceutical frontiers, developing cutting-edge agrochemicals, or engineering advanced materials, Traumatin's remarkable potential can be the key to unlocking groundbreaking advancements.

To delve deeper into the technical details, applications, and safety guidelines surrounding Traumatin, we encourage you to consult the available resources, including scientific literature, technical data sheets, and safety information. These comprehensive sources will provide you with the necessary insights to harness the full potential of this captivating fatty acid compound and propel your research or development projects to new heights.

• C